C13H15NO4S — CID 75020431
2-hydroxy-4-oxo-4-(5-piperidin-1-ylthiophen-2-yl)but-2-enoic acid (PubChem CID 75020431) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-hydroxy-4-oxo-4-(5-piperidin-1-ylthiophen-2-yl)but-2-enoic acid.
| Compound Name | 2-hydroxy-4-oxo-4-(5-piperidin-1-ylthiophen-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 75020431 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-hydroxy-4-oxo-4-(5-piperidin-1-ylthiophen-2-yl)but-2-enoic acid |
| SMILES | O=C(O)C(O)=CC(=O)c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C13H15NO4S/c15-9(8-10(16)13(17)18)11-4-5-12(19-11)14-6-2-1-3-7-14/h4-5,8,16H,1-3,6-7H2,(H,17,18) |
| InChIKey | YOXZCJQHSWTNTH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|