C14H14F2N2O2S — CID 172568022
(4E)-3-(difluoromethyl)-4-[(5-piperidin-1-ylthiophen-2-yl)methylidene]-1,2-oxazol-5-one (PubChem CID 172568022) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is (4E)-3-(difluoromethyl)-4-[(5-piperidin-1-ylthiophen-2-yl)methylidene]-1,2-oxazol-5-one.
| Compound Name | (4E)-3-(difluoromethyl)-4-[(5-piperidin-1-ylthiophen-2-yl)methylidene]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 172568022 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (4E)-3-(difluoromethyl)-4-[(5-piperidin-1-ylthiophen-2-yl)methylidene]-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(C(F)F)/C1=C\c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C14H14F2N2O2S/c15-13(16)12-10(14(19)20-17-12)8-9-4-5-11(21-9)18-6-2-1-3-7-18/h4-5,8,13H,1-3,6-7H2/b10-8+ |
| InChIKey | OCZVGAJYPNLSCI-CSKARUKUSA-N |
| XLogP | 3.30 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|