C25H29N3O2 — CID 40524529
2-[4-(diethylamino)anilino]-3-piperidin-1-ylnaphthalene-1,4-dione (PubChem CID 40524529) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[4-(diethylamino)anilino]-3-piperidin-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-[4-(diethylamino)anilino]-3-piperidin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 40524529 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[4-(diethylamino)anilino]-3-piperidin-1-ylnaphthalene-1,4-dione |
| SMILES | CCN(CC)c1ccc(NC2=C(N3CCCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H29N3O2/c1-3-27(4-2)19-14-12-18(13-15-19)26-22-23(28-16-8-5-9-17-28)25(30)21-11-7-6-10-20(21)24(22)29/h6-7,10-15,26H,3-5,8-9,16-17H2,1-2H3 |
| InChIKey | KOBAWBCJWYJCMG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|