C22H19F3N2O2 — CID 3887932
2-piperidin-1-yl-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione (PubChem CID 3887932) has the molecular formula C22H19F3N2O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-piperidin-1-yl-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione.
| Compound Name | 2-piperidin-1-yl-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 3887932 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-piperidin-1-yl-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione |
| SMILES | O=C1C(Nc2cccc(C(F)(F)F)c2)=C(N2CCCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H19F3N2O2/c23-22(24,25)14-7-6-8-15(13-14)26-18-19(27-11-4-1-5-12-27)21(29)17-10-3-2-9-16(17)20(18)28/h2-3,6-10,13,26H,1,4-5,11-12H2 |
| InChIKey | YUPQBVILGOEJEC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|