C22H21F3N4 — CID 140539776
6-(4-piperidin-1-ylphenyl)-N-[3-(trifluoromethyl)phenyl]pyridazin-3-amine (PubChem CID 140539776) has the molecular formula C22H21F3N4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 6-(4-piperidin-1-ylphenyl)-N-[3-(trifluoromethyl)phenyl]pyridazin-3-amine.
| Compound Name | 6-(4-piperidin-1-ylphenyl)-N-[3-(trifluoromethyl)phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 140539776 |
| Molecular Formula | C22H21F3N4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 6-(4-piperidin-1-ylphenyl)-N-[3-(trifluoromethyl)phenyl]pyridazin-3-amine |
| SMILES | FC(F)(F)c1cccc(Nc2ccc(-c3ccc(N4CCCCC4)cc3)nn2)c1 |
| InChI | InChI=1S/C22H21F3N4/c23-22(24,25)17-5-4-6-18(15-17)26-21-12-11-20(27-28-21)16-7-9-19(10-8-16)29-13-2-1-3-14-29/h4-12,15H,1-3,13-14H2,(H,26,28) |
| InChIKey | CDBMBSFBCVPJHZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |