C19H20F3N3 — CID 110841699
N-[(4-piperidin-1-ylphenyl)methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 110841699) has the molecular formula C19H20F3N3 and a molecular weight of 347.38 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylphenyl)methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(4-piperidin-1-ylphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841699 |
| Molecular Formula | C19H20F3N3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[(4-piperidin-1-ylphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(NN=Cc2ccc(N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C19H20F3N3/c20-19(21,22)16-5-4-6-17(13-16)24-23-14-15-7-9-18(10-8-15)25-11-2-1-3-12-25/h4-10,13-14,24H,1-3,11-12H2 |
| InChIKey | QZINNTZCCOGRRW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|