C18H19F3N4 — CID 7933190
N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 7933190) has the molecular formula C18H19F3N4 and a molecular weight of 348.37 g/mol. Its IUPAC name is N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 7933190 |
| Molecular Formula | C18H19F3N4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[(Z)-(4-piperidin-1-ylphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2ccc(N3CCCCC3)cc2)nc1 |
| InChI | InChI=1S/C18H19F3N4/c19-18(20,21)15-6-9-17(22-13-15)24-23-12-14-4-7-16(8-5-14)25-10-2-1-3-11-25/h4-9,12-13H,1-3,10-11H2,(H,22,24)/b23-12- |
| InChIKey | SSQVQSYJLYNQJN-FMCGGJTJSA-N |
| XLogP | 4.54 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|