C17H12F4N4 — CID 126077830
N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126077830) has the molecular formula C17H12F4N4 and a molecular weight of 348.30 g/mol. Its IUPAC name is N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126077830 |
| Molecular Formula | C17H12F4N4 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[(Z)-[1-(4-fluorophenyl)pyrrol-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Fc1ccc(-n2cccc2/C=N\Nc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C17H12F4N4/c18-13-4-6-14(7-5-13)25-9-1-2-15(25)11-23-24-16-8-3-12(10-22-16)17(19,20)21/h1-11H,(H,22,24)/b23-11- |
| InChIKey | RLFKVRDDDYVXEA-KSEXSDGBSA-N |
| XLogP | 4.48 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|