C17H9ClF3NO2 — CID 1380393
2-chloro-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione (PubChem CID 1380393) has the molecular formula C17H9ClF3NO2 and a molecular weight of 351.71 g/mol. Its IUPAC name is 2-chloro-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 1380393 |
| Molecular Formula | C17H9ClF3NO2 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-chloro-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Nc2cccc(C(F)(F)F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H9ClF3NO2/c18-13-14(16(24)12-7-2-1-6-11(12)15(13)23)22-10-5-3-4-9(8-10)17(19,20)21/h1-8,22H |
| InChIKey | FSTVLAQUGNREID-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|