C16H8ClF2NO2 — CID 883791
2-chloro-3-(3,4-difluoroanilino)naphthalene-1,4-dione (PubChem CID 883791) has the molecular formula C16H8ClF2NO2 and a molecular weight of 319.69 g/mol. Its IUPAC name is 2-chloro-3-(3,4-difluoroanilino)naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(3,4-difluoroanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 883791 |
| Molecular Formula | C16H8ClF2NO2 |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-chloro-3-(3,4-difluoroanilino)naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Nc2ccc(F)c(F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H8ClF2NO2/c17-13-14(20-8-5-6-11(18)12(19)7-8)16(22)10-4-2-1-3-9(10)15(13)21/h1-7,20H |
| InChIKey | DWIVXKJTVKYOLH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|