C22H10F4O2 — CID 154722109
2,3-bis(3,4-difluorophenyl)naphthalene-1,4-dione (PubChem CID 154722109) has the molecular formula C22H10F4O2 and a molecular weight of 382.31 g/mol. Its IUPAC name is 2,3-bis(3,4-difluorophenyl)naphthalene-1,4-dione.
| Compound Name | 2,3-bis(3,4-difluorophenyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 154722109 |
| Molecular Formula | C22H10F4O2 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2,3-bis(3,4-difluorophenyl)naphthalene-1,4-dione |
| SMILES | O=C1C(c2ccc(F)c(F)c2)=C(c2ccc(F)c(F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H10F4O2/c23-15-7-5-11(9-17(15)25)19-20(12-6-8-16(24)18(26)10-12)22(28)14-4-2-1-3-13(14)21(19)27/h1-10H |
| InChIKey | MIXUJTKGMOHGHO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|