C32H16Cl2O4 — CID 141466090
6-chloro-3-(7-chloro-1,4-dioxo-3-phenylnaphthalen-2-yl)-2-phenylnaphthalene-1,4-dione (PubChem CID 141466090) has the molecular formula C32H16Cl2O4 and a molecular weight of 535.38 g/mol. Its IUPAC name is 6-chloro-3-(7-chloro-1,4-dioxo-3-phenylnaphthalen-2-yl)-2-phenylnaphthalene-1,4-dione.
| Compound Name | 6-chloro-3-(7-chloro-1,4-dioxo-3-phenylnaphthalen-2-yl)-2-phenylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 141466090 |
| Molecular Formula | C32H16Cl2O4 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 6-chloro-3-(7-chloro-1,4-dioxo-3-phenylnaphthalen-2-yl)-2-phenylnaphthalene-1,4-dione |
| SMILES | O=C1C(C2=C(c3ccccc3)C(=O)c3ccc(Cl)cc3C2=O)=C(c2ccccc2)C(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C32H16Cl2O4/c33-19-11-13-21-23(15-19)31(37)27(25(29(21)35)17-7-3-1-4-8-17)28-26(18-9-5-2-6-10-18)30(36)22-14-12-20(34)16-24(22)32(28)38/h1-16H |
| InChIKey | VPGLEDGXVAHDBW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|