C16H10ClNO2 — CID 90646353
2-amino-3-(3-chlorophenyl)naphthalene-1,4-dione (PubChem CID 90646353) has the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-amino-3-(3-chlorophenyl)naphthalene-1,4-dione.
| Compound Name | 2-amino-3-(3-chlorophenyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 90646353 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-amino-3-(3-chlorophenyl)naphthalene-1,4-dione |
| SMILES | NC1=C(c2cccc(Cl)c2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H10ClNO2/c17-10-5-3-4-9(8-10)13-14(18)16(20)12-7-2-1-6-11(12)15(13)19/h1-8H,18H2 |
| InChIKey | LWMYDKVPHFMJQS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|