C18H11Cl3 — CID 54080795
2-chloro-1,3-bis(3-chlorophenyl)benzene (PubChem CID 54080795) has the molecular formula C18H11Cl3 and a molecular weight of 333.65 g/mol. Its IUPAC name is 2-chloro-1,3-bis(3-chlorophenyl)benzene.
| Compound Name | 2-chloro-1,3-bis(3-chlorophenyl)benzene |
|---|---|
| PubChem CID | 54080795 |
| Molecular Formula | C18H11Cl3 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2-chloro-1,3-bis(3-chlorophenyl)benzene |
| SMILES | Clc1cccc(-c2cccc(-c3cccc(Cl)c3)c2Cl)c1 |
| InChI | InChI=1S/C18H11Cl3/c19-14-6-1-4-12(10-14)16-8-3-9-17(18(16)21)13-5-2-7-15(20)11-13/h1-11H |
| InChIKey | DBIFUSZQETVHAE-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |