C14H10 — CID 101119071
tricyclo[6.6.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene (PubChem CID 101119071) has the molecular formula C14H10 and a molecular weight of 178.23 g/mol. Its IUPAC name is tricyclo[6.6.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | tricyclo[6.6.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 101119071 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | tricyclo[6.6.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene |
| SMILES | c1cccc2c3cccc-3cc-2cc1 |
| InChI | InChI=1S/C14H10/c1-2-4-8-13-11(6-3-1)10-12-7-5-9-14(12)13/h1-10H/b2-1-,3-1-,4-2-,6-3-,8-4-,11-6-,13-8+ |
| InChIKey | JNNAJDPQBMLQPK-OCPQDPRZSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |