About 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane
1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane (PubChem CID 162138602) has the molecular formula C61H46
and a molecular weight of 779.04 g/mol. Its IUPAC name is 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane.
Molecular Properties
| Compound Name | 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane |
| PubChem CID | 162138602 |
| Molecular Formula | C61H46 |
| Molecular Weight | 779.04 g/mol |
| Exact Mass | 778.36 |
| IUPAC Name | 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane |
| SMILES | C.c1ccc2cc(-c3cc4cccccc-4c3)cc-2cc1.c1ccc2cc(-c3ccccc4cccc3-4)cc-2cc1.c1ccc2ccc(-c3ccc4cccccc3-4)c-2cc1 |
| InChI | InChI=1S/3C20H14.CH4/c1-3-7-15-11-13-19(17(15)9-5-1)20-14-12-16-8-4-2-6-10-18(16)20;1-3-7-15-11-19(12-16(15)8-4-1)20-13-17-9-5-2-6-10-18(17)14-20;1-2-8-16-13-18(14-17(16)9-3-1)20-11-5-4-7-15-10-6-12-19(15)20;/h3*1-14H;1H4 |
| InChIKey | ZJPZDFDPIYVQKF-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 779.04 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane?
The IUPAC name of 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane (CID 162138602) is 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane.
What is the SMILES notation for 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane?
The canonical SMILES for 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane is C.c1ccc2cc(-c3cc4cccccc-4c3)cc-2cc1.c1ccc2cc(-c3ccccc4cccc3-4)cc-2cc1.c1ccc2ccc(-c3ccc4cccccc3-4)c-2cc1.
What is the InChIKey of 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane?
The InChIKey is ZJPZDFDPIYVQKF-UHFFFAOYSA-N. The full InChI is InChI=1S/3C20H14.CH4/c1-3-7-15-11-13-19(17(15)9-5-1)20-14-12-16-8-4-2-6-10-18(16)20;1-3-7-15-11-19(12-16(15)8-4-1)20-13-17-9-5-2-6-10-18(17)14-20;1-2-8-16-13-18(14-17(16)9-3-1)20-11-5-4-7-15-10-6-12-19(15)20;/h3*1-14H;1H4.
What are the key properties of 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane?
1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane has a molecular weight of 779.04 g/mol, XLogP of 17.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azulen-1-ylazulene;2-azulen-2-ylazulene;2-azulen-4-ylazulene;methane is sourced from PubChem (CID 162138602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).