About 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine
1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine (PubChem CID 174888350) has the molecular formula C43H35N
and a molecular weight of 565.76 g/mol. Its IUPAC name is 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine.
Molecular Properties
| Compound Name | 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine |
| PubChem CID | 174888350 |
| Molecular Formula | C43H35N |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine |
| SMILES | CN.c1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C42H30.CH5N/c1-5-15-31(16-6-1)35-25-36(32-17-7-2-8-18-32)28-39(27-35)41-23-13-14-24-42(41)40-29-37(33-19-9-3-10-20-33)26-38(30-40)34-21-11-4-12-22-34;1-2/h1-30H;2H2,1H3 |
| InChIKey | GPUSXCNACKPJPF-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine?
The IUPAC name of 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine (CID 174888350) is 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine.
What is the SMILES notation for 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine?
The canonical SMILES for 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine is CN.c1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)cc1.
What is the InChIKey of 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine?
The InChIKey is GPUSXCNACKPJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H30.CH5N/c1-5-15-31(16-6-1)35-25-36(32-17-7-2-8-18-32)28-39(27-35)41-23-13-14-24-42(41)40-29-37(33-19-9-3-10-20-33)26-38(30-40)34-21-11-4-12-22-34;1-2/h1-30H;2H2,1H3.
What are the key properties of 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine?
1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine has a molecular weight of 565.76 g/mol, XLogP of 11.26, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,5-diphenylphenyl)phenyl]-3,5-diphenylbenzene;methanamine is sourced from PubChem (CID 174888350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).