About 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one
7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one (PubChem CID 88621365) has the molecular formula C22H13ClOS
and a molecular weight of 360.87 g/mol. Its IUPAC name is 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one.
Molecular Properties
| Compound Name | 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one |
| PubChem CID | 88621365 |
| Molecular Formula | C22H13ClOS |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=S)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H13ClOS/c23-16-11-12-17-18(13-16)21(24)19(14-7-3-1-4-8-14)20(22(17)25)15-9-5-2-6-10-15/h1-13H |
| InChIKey | BYQKQSLIOKTWOW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one?
The IUPAC name of 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one (CID 88621365) is 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one.
What is the SMILES notation for 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one?
The canonical SMILES for 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one is O=C1C(c2ccccc2)=C(c2ccccc2)C(=S)c2ccc(Cl)cc21.
What is the InChIKey of 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one?
The InChIKey is BYQKQSLIOKTWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13ClOS/c23-16-11-12-17-18(13-16)21(24)19(14-7-3-1-4-8-14)20(22(17)25)15-9-5-2-6-10-15/h1-13H.
What are the key properties of 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one?
7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one has a molecular weight of 360.87 g/mol, XLogP of 5.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-diphenyl-4-sulfanylidenenaphthalen-1-one is sourced from PubChem (CID 88621365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).