C34H22O4 — CID 141466102
2-(4-methylphenyl)-3-[3-(4-methylphenyl)-1,4-dioxonaphthalen-2-yl]naphthalene-1,4-dione (PubChem CID 141466102) has the molecular formula C34H22O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-[3-(4-methylphenyl)-1,4-dioxonaphthalen-2-yl]naphthalene-1,4-dione.
| Compound Name | 2-(4-methylphenyl)-3-[3-(4-methylphenyl)-1,4-dioxonaphthalen-2-yl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 141466102 |
| Molecular Formula | C34H22O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-(4-methylphenyl)-3-[3-(4-methylphenyl)-1,4-dioxonaphthalen-2-yl]naphthalene-1,4-dione |
| SMILES | Cc1ccc(C2=C(C3=C(c4ccc(C)cc4)C(=O)c4ccccc4C3=O)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C34H22O4/c1-19-11-15-21(16-12-19)27-29(33(37)25-9-5-3-7-23(25)31(27)35)30-28(22-17-13-20(2)14-18-22)32(36)24-8-4-6-10-26(24)34(30)38/h3-18H,1-2H3 |
| InChIKey | PWTJROJAUFUYER-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|