C17H12ClNO3 — CID 4184980
2-chloro-3-(4-methoxyanilino)naphthalene-1,4-dione (PubChem CID 4184980) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-chloro-3-(4-methoxyanilino)naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(4-methoxyanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 4184980 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-chloro-3-(4-methoxyanilino)naphthalene-1,4-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H12ClNO3/c1-22-11-8-6-10(7-9-11)19-15-14(18)16(20)12-4-2-3-5-13(12)17(15)21/h2-9,19H,1H3 |
| InChIKey | PNCXGGPCNXABHQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|