C16H11ClN2O3 — CID 10335823
6-chloro-7-(4-methoxyanilino)isoquinoline-5,8-dione (PubChem CID 10335823) has the molecular formula C16H11ClN2O3 and a molecular weight of 314.73 g/mol. Its IUPAC name is 6-chloro-7-(4-methoxyanilino)isoquinoline-5,8-dione.
| Compound Name | 6-chloro-7-(4-methoxyanilino)isoquinoline-5,8-dione |
|---|---|
| PubChem CID | 10335823 |
| Molecular Formula | C16H11ClN2O3 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 6-chloro-7-(4-methoxyanilino)isoquinoline-5,8-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)c3ccncc3C2=O)cc1 |
| InChI | InChI=1S/C16H11ClN2O3/c1-22-10-4-2-9(3-5-10)19-14-13(17)15(20)11-6-7-18-8-12(11)16(14)21/h2-8,19H,1H3 |
| InChIKey | DMRNLJKRCVCUHO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|