C19H13ClN4O3 — CID 500944
6-chloro-5-(4-methoxyanilino)-2-pyridin-3-yl-1H-benzimidazole-4,7-dione (PubChem CID 500944) has the molecular formula C19H13ClN4O3 and a molecular weight of 380.79 g/mol. Its IUPAC name is 6-chloro-5-(4-methoxyanilino)-2-pyridin-3-yl-1H-benzimidazole-4,7-dione.
| Compound Name | 6-chloro-5-(4-methoxyanilino)-2-pyridin-3-yl-1H-benzimidazole-4,7-dione |
|---|---|
| PubChem CID | 500944 |
| Molecular Formula | C19H13ClN4O3 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 6-chloro-5-(4-methoxyanilino)-2-pyridin-3-yl-1H-benzimidazole-4,7-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)c3[nH]c(-c4cccnc4)nc3C2=O)cc1 |
| InChI | InChI=1S/C19H13ClN4O3/c1-27-12-6-4-11(5-7-12)22-14-13(20)17(25)15-16(18(14)26)24-19(23-15)10-3-2-8-21-9-10/h2-9,22H,1H3,(H,23,24) |
| InChIKey | VWNXAJXKEBEAOO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|