C17H13ClN2O3 — CID 10336650
6-chloro-7-(4-ethoxyanilino)isoquinoline-5,8-dione (PubChem CID 10336650) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is 6-chloro-7-(4-ethoxyanilino)isoquinoline-5,8-dione.
| Compound Name | 6-chloro-7-(4-ethoxyanilino)isoquinoline-5,8-dione |
|---|---|
| PubChem CID | 10336650 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 6-chloro-7-(4-ethoxyanilino)isoquinoline-5,8-dione |
| SMILES | CCOc1ccc(NC2=C(Cl)C(=O)c3ccncc3C2=O)cc1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-2-23-11-5-3-10(4-6-11)20-15-14(18)16(21)12-7-8-19-9-13(12)17(15)22/h3-9,20H,2H2,1H3 |
| InChIKey | NKFVQRVUZXSWTH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|