C16H12ClN3O3 — CID 142671434
6-chloro-7-(4-ethoxyanilino)phthalazine-5,8-dione (PubChem CID 142671434) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is 6-chloro-7-(4-ethoxyanilino)phthalazine-5,8-dione.
| Compound Name | 6-chloro-7-(4-ethoxyanilino)phthalazine-5,8-dione |
|---|---|
| PubChem CID | 142671434 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 6-chloro-7-(4-ethoxyanilino)phthalazine-5,8-dione |
| SMILES | CCOc1ccc(NC2=C(Cl)C(=O)c3cnncc3C2=O)cc1 |
| InChI | InChI=1S/C16H12ClN3O3/c1-2-23-10-5-3-9(4-6-10)20-14-13(17)15(21)11-7-18-19-8-12(11)16(14)22/h3-8,20H,2H2,1H3 |
| InChIKey | KIFRVYYIIBTTDX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|