C20H13Cl2N3 — CID 150000034
3-[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]pyridine (PubChem CID 150000034) has the molecular formula C20H13Cl2N3 and a molecular weight of 366.25 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]pyridine.
| Compound Name | 3-[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 150000034 |
| Molecular Formula | C20H13Cl2N3 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]pyridine |
| SMILES | Clc1cccc(-c2[nH]c(-c3cccnc3)nc2-c2ccccc2)c1Cl |
| InChI | InChI=1S/C20H13Cl2N3/c21-16-10-4-9-15(17(16)22)19-18(13-6-2-1-3-7-13)24-20(25-19)14-8-5-11-23-12-14/h1-12H,(H,24,25) |
| InChIKey | DBBWLWBUIOBPDR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|