C19H13Cl2N3 — CID 152504378
5-(2,6-dichlorophenyl)-4-phenyl-2-(1H-pyrrol-3-yl)-1H-imidazole (PubChem CID 152504378) has the molecular formula C19H13Cl2N3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-4-phenyl-2-(1H-pyrrol-3-yl)-1H-imidazole.
| Compound Name | 5-(2,6-dichlorophenyl)-4-phenyl-2-(1H-pyrrol-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 152504378 |
| Molecular Formula | C19H13Cl2N3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-4-phenyl-2-(1H-pyrrol-3-yl)-1H-imidazole |
| SMILES | Clc1cccc(Cl)c1-c1[nH]c(-c2cc[nH]c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H13Cl2N3/c20-14-7-4-8-15(21)16(14)18-17(12-5-2-1-3-6-12)23-19(24-18)13-9-10-22-11-13/h1-11,22H,(H,23,24) |
| InChIKey | YEDKCAJVQQPXNE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|