C21H19N3O2 — CID 135968526
4,5-bis(4-methoxyphenyl)-2-(1H-pyrrol-3-yl)-1H-imidazole (PubChem CID 135968526) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-(1H-pyrrol-3-yl)-1H-imidazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-(1H-pyrrol-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 135968526 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-(1H-pyrrol-3-yl)-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3cc[nH]c3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H19N3O2/c1-25-17-7-3-14(4-8-17)19-20(15-5-9-18(26-2)10-6-15)24-21(23-19)16-11-12-22-13-16/h3-13,22H,1-2H3,(H,23,24) |
| InChIKey | KSHFRFOGOBVDTI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|