C22H20N2O3 — CID 40532851
4,5-bis(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1H-imidazole (PubChem CID 40532851) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1H-imidazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 40532851 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3ccc(C)o3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O3/c1-14-4-13-19(27-14)22-23-20(15-5-9-17(25-2)10-6-15)21(24-22)16-7-11-18(26-3)12-8-16/h4-13H,1-3H3,(H,23,24) |
| InChIKey | RXLISILRNYHBSS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|