C21H15Cl2N3 — CID 150611766
3-[[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]methyl]pyridine (PubChem CID 150611766) has the molecular formula C21H15Cl2N3 and a molecular weight of 380.28 g/mol. Its IUPAC name is 3-[[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]methyl]pyridine.
| Compound Name | 3-[[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 150611766 |
| Molecular Formula | C21H15Cl2N3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 3-[[5-(2,3-dichlorophenyl)-4-phenyl-1H-imidazol-2-yl]methyl]pyridine |
| SMILES | Clc1cccc(-c2[nH]c(Cc3cccnc3)nc2-c2ccccc2)c1Cl |
| InChI | InChI=1S/C21H15Cl2N3/c22-17-10-4-9-16(19(17)23)21-20(15-7-2-1-3-8-15)25-18(26-21)12-14-6-5-11-24-13-14/h1-11,13H,12H2,(H,25,26) |
| InChIKey | IUAZJYSGXDYHIO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |