C37H41ClN4 — CID 176776059
2-(4-chloro-3-pyridinyl)-3-[4-phenyl-5-(2,4,6-tritert-butylphenyl)-1H-imidazol-2-yl]pyridine (PubChem CID 176776059) has the molecular formula C37H41ClN4 and a molecular weight of 577.22 g/mol. Its IUPAC name is 2-(4-chloro-3-pyridinyl)-3-[4-phenyl-5-(2,4,6-tritert-butylphenyl)-1H-imidazol-2-yl]pyridine.
| Compound Name | 2-(4-chloro-3-pyridinyl)-3-[4-phenyl-5-(2,4,6-tritert-butylphenyl)-1H-imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 176776059 |
| Molecular Formula | C37H41ClN4 |
| Molecular Weight | 577.22 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 2-(4-chloro-3-pyridinyl)-3-[4-phenyl-5-(2,4,6-tritert-butylphenyl)-1H-imidazol-2-yl]pyridine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2[nH]c(-c3cccnc3-c3cnccc3Cl)nc2-c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H41ClN4/c1-35(2,3)24-20-27(36(4,5)6)30(28(21-24)37(7,8)9)33-31(23-14-11-10-12-15-23)41-34(42-33)25-16-13-18-40-32(25)26-22-39-19-17-29(26)38/h10-22H,1-9H3,(H,41,42) |
| InChIKey | VWGHVGXPUHIDEE-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.22 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|