C35H41N — CID 176828009
3-[4-tert-butyl-2,6-bis(2-tert-butylphenyl)phenyl]pyridine (PubChem CID 176828009) has the molecular formula C35H41N and a molecular weight of 475.72 g/mol. Its IUPAC name is 3-[4-tert-butyl-2,6-bis(2-tert-butylphenyl)phenyl]pyridine.
| Compound Name | 3-[4-tert-butyl-2,6-bis(2-tert-butylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 176828009 |
| Molecular Formula | C35H41N |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 3-[4-tert-butyl-2,6-bis(2-tert-butylphenyl)phenyl]pyridine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2C(C)(C)C)c(-c2cccnc2)c(-c2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C35H41N/c1-33(2,3)25-21-28(26-16-10-12-18-30(26)34(4,5)6)32(24-15-14-20-36-23-24)29(22-25)27-17-11-13-19-31(27)35(7,8)9/h10-23H,1-9H3 |
| InChIKey | BEUSLJTZIXXDDM-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |