C62H86 — CID 176589329
1,4-ditert-butyl-2,5-bis(2-tert-butylphenyl)-3,6-bis(3,5-ditert-butylphenyl)benzene (PubChem CID 176589329) has the molecular formula C62H86 and a molecular weight of 831.37 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,5-bis(2-tert-butylphenyl)-3,6-bis(3,5-ditert-butylphenyl)benzene.
| Compound Name | 1,4-ditert-butyl-2,5-bis(2-tert-butylphenyl)-3,6-bis(3,5-ditert-butylphenyl)benzene |
|---|---|
| PubChem CID | 176589329 |
| Molecular Formula | C62H86 |
| Molecular Weight | 831.37 g/mol |
| Exact Mass | 830.67 |
| IUPAC Name | 1,4-ditert-butyl-2,5-bis(2-tert-butylphenyl)-3,6-bis(3,5-ditert-butylphenyl)benzene |
| SMILES | CC(C)(C)c1cc(-c2c(-c3ccccc3C(C)(C)C)c(C(C)(C)C)c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c(-c3ccccc3C(C)(C)C)c2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H86/c1-55(2,3)41-33-39(34-42(37-41)56(4,5)6)49-51(45-29-25-27-31-47(45)59(13,14)15)54(62(22,23)24)50(40-35-43(57(7,8)9)38-44(36-40)58(10,11)12)52(53(49)61(19,20)21)46-30-26-28-32-48(46)60(16,17)18/h25-38H,1-24H3 |
| InChIKey | ZSCJIRSLQXNQNE-UHFFFAOYSA-N |
| XLogP | 18.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.37 |
| LogP ≤ 5 | 18.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |