C66H78 — CID 90735400
1,2,3,4,5-pentatert-butyl-6-[2-(2-tert-butylphenyl)-3,4,5,6-tetraphenylphenyl]benzene (PubChem CID 90735400) has the molecular formula C66H78 and a molecular weight of 871.35 g/mol. Its IUPAC name is 1,2,3,4,5-pentatert-butyl-6-[2-(2-tert-butylphenyl)-3,4,5,6-tetraphenylphenyl]benzene.
| Compound Name | 1,2,3,4,5-pentatert-butyl-6-[2-(2-tert-butylphenyl)-3,4,5,6-tetraphenylphenyl]benzene |
|---|---|
| PubChem CID | 90735400 |
| Molecular Formula | C66H78 |
| Molecular Weight | 871.35 g/mol |
| Exact Mass | 870.61 |
| IUPAC Name | 1,2,3,4,5-pentatert-butyl-6-[2-(2-tert-butylphenyl)-3,4,5,6-tetraphenylphenyl]benzene |
| SMILES | CC(C)(C)c1ccccc1-c1c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1c(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C66H78/c1-61(2,3)48-42-32-31-41-47(48)53-51(45-37-27-21-28-38-45)49(43-33-23-19-24-34-43)50(44-35-25-20-26-36-44)52(46-39-29-22-30-40-46)54(53)55-56(62(4,5)6)58(64(10,11)12)60(66(16,17)18)59(65(13,14)15)57(55)63(7,8)9/h19-42H,1-18H3 |
| InChIKey | XVRORDKOBHVUHJ-UHFFFAOYSA-N |
| XLogP | 19.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.35 |
| LogP ≤ 5 | 19.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |