C16H13F5 — CID 54238945
1-(2-tert-butylphenyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 54238945) has the molecular formula C16H13F5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(2-tert-butylphenyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 54238945 |
| Molecular Formula | C16H13F5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(2-tert-butylphenyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | CC(C)(C)c1ccccc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H13F5/c1-16(2,3)9-7-5-4-6-8(9)10-11(17)13(19)15(21)14(20)12(10)18/h4-7H,1-3H3 |
| InChIKey | QOPNEXSXCXEJTD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|