C24H22F2N+ — CID 177117647
9-(2-tert-butylphenyl)-2,7-difluoro-10-methylacridin-10-ium (PubChem CID 177117647) has the molecular formula C24H22F2N+ and a molecular weight of 362.44 g/mol. Its IUPAC name is 9-(2-tert-butylphenyl)-2,7-difluoro-10-methylacridin-10-ium.
| Compound Name | 9-(2-tert-butylphenyl)-2,7-difluoro-10-methylacridin-10-ium |
|---|---|
| PubChem CID | 177117647 |
| Molecular Formula | C24H22F2N+ |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 9-(2-tert-butylphenyl)-2,7-difluoro-10-methylacridin-10-ium |
| SMILES | C[n+]1c2ccc(F)cc2c(-c2ccccc2C(C)(C)C)c2cc(F)ccc21 |
| InChI | InChI=1S/C24H22F2N/c1-24(2,3)20-8-6-5-7-17(20)23-18-13-15(25)9-11-21(18)27(4)22-12-10-16(26)14-19(22)23/h5-14H,1-4H3/q+1 |
| InChIKey | WWVMKNVIXVJNEH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|