C20H9Br2F5N+ — CID 177117630
2,7-dibromo-10-methyl-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium (PubChem CID 177117630) has the molecular formula C20H9Br2F5N+ and a molecular weight of 518.10 g/mol. Its IUPAC name is 2,7-dibromo-10-methyl-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium.
| Compound Name | 2,7-dibromo-10-methyl-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium |
|---|---|
| PubChem CID | 177117630 |
| Molecular Formula | C20H9Br2F5N+ |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 515.90 |
| IUPAC Name | 2,7-dibromo-10-methyl-9-(2,3,4,5,6-pentafluorophenyl)acridin-10-ium |
| SMILES | C[n+]1c2ccc(Br)cc2c(-c2c(F)c(F)c(F)c(F)c2F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H9Br2F5N/c1-28-12-4-2-8(21)6-10(12)14(11-7-9(22)3-5-13(11)28)15-16(23)18(25)20(27)19(26)17(15)24/h2-7H,1H3/q+1 |
| InChIKey | PSMBKCRRDGXLQL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|