C19H3BrF9N — CID 56834787
7-bromo-1,2,3,4-tetrafluoro-9-(2,3,4,5,6-pentafluorophenyl)acridine (PubChem CID 56834787) has the molecular formula C19H3BrF9N and a molecular weight of 496.13 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrafluoro-9-(2,3,4,5,6-pentafluorophenyl)acridine.
| Compound Name | 7-bromo-1,2,3,4-tetrafluoro-9-(2,3,4,5,6-pentafluorophenyl)acridine |
|---|---|
| PubChem CID | 56834787 |
| Molecular Formula | C19H3BrF9N |
| Molecular Weight | 496.13 g/mol |
| Exact Mass | 494.93 |
| IUPAC Name | 7-bromo-1,2,3,4-tetrafluoro-9-(2,3,4,5,6-pentafluorophenyl)acridine |
| SMILES | Fc1c(F)c(F)c(-c2c3cc(Br)ccc3nc3c(F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C19H3BrF9N/c20-4-1-2-6-5(3-4)7(8-10(21)13(24)16(27)14(25)11(8)22)9-12(23)15(26)17(28)18(29)19(9)30-6/h1-3H |
| InChIKey | QUQFISZGUYNOLI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.13 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|