C18H13BrF3NO2S — CID 12001725
6-bromo-2-methyl-3-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]quinoline (PubChem CID 12001725) has the molecular formula C18H13BrF3NO2S and a molecular weight of 444.27 g/mol. Its IUPAC name is 6-bromo-2-methyl-3-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]quinoline.
| Compound Name | 6-bromo-2-methyl-3-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]quinoline |
|---|---|
| PubChem CID | 12001725 |
| Molecular Formula | C18H13BrF3NO2S |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | 6-bromo-2-methyl-3-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]quinoline |
| SMILES | Cc1nc2ccc(Br)cc2c(-c2ccc(C(F)(F)F)cc2)c1S(C)(=O)=O |
| InChI | InChI=1S/C18H13BrF3NO2S/c1-10-17(26(2,24)25)16(14-9-13(19)7-8-15(14)23-10)11-3-5-12(6-4-11)18(20,21)22/h3-9H,1-2H3 |
| InChIKey | XEWLPRHOCAAEJT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |