C8H3Br3N2 — CID 162731871
1,4,6-tribromophthalazine (PubChem CID 162731871) has the molecular formula C8H3Br3N2 and a molecular weight of 366.84 g/mol. Its IUPAC name is 1,4,6-tribromophthalazine.
| Compound Name | 1,4,6-tribromophthalazine |
|---|---|
| PubChem CID | 162731871 |
| Molecular Formula | C8H3Br3N2 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 363.78 |
| IUPAC Name | 1,4,6-tribromophthalazine |
| SMILES | Brc1ccc2c(Br)nnc(Br)c2c1 |
| InChI | InChI=1S/C8H3Br3N2/c9-4-1-2-5-6(3-4)8(11)13-12-7(5)10/h1-3H |
| InChIKey | BHCMBAQZAWALPH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |