C8H6Br2N2 — CID 76846072
3,6-dibromo-1-methylindazole (PubChem CID 76846072) has the molecular formula C8H6Br2N2 and a molecular weight of 289.96 g/mol. Its IUPAC name is 3,6-dibromo-1-methylindazole.
| Compound Name | 3,6-dibromo-1-methylindazole |
|---|---|
| PubChem CID | 76846072 |
| Molecular Formula | C8H6Br2N2 |
| Molecular Weight | 289.96 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | 3,6-dibromo-1-methylindazole |
| SMILES | Cn1nc(Br)c2ccc(Br)cc21 |
| InChI | InChI=1S/C8H6Br2N2/c1-12-7-4-5(9)2-3-6(7)8(10)11-12/h2-4H,1H3 |
| InChIKey | SLOIWCYHKMLLGV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.96 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |