About 6-bromo-1,3-dimethylindazole;ethane
6-bromo-1,3-dimethylindazole;ethane (PubChem CID 145062136) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 6-bromo-1,3-dimethylindazole;ethane.
Molecular Properties
| Compound Name | 6-bromo-1,3-dimethylindazole;ethane |
| PubChem CID | 145062136 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 6-bromo-1,3-dimethylindazole;ethane |
| SMILES | CC.Cc1nn(C)c2cc(Br)ccc12 |
| InChI | InChI=1S/C9H9BrN2.C2H6/c1-6-8-4-3-7(10)5-9(8)12(2)11-6;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | DPLBHZDWMHABDW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1,3-dimethylindazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-dimethylindazole;ethane?
The IUPAC name of 6-bromo-1,3-dimethylindazole;ethane (CID 145062136) is 6-bromo-1,3-dimethylindazole;ethane.
What is the SMILES notation for 6-bromo-1,3-dimethylindazole;ethane?
The canonical SMILES for 6-bromo-1,3-dimethylindazole;ethane is CC.Cc1nn(C)c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-1,3-dimethylindazole;ethane?
The InChIKey is DPLBHZDWMHABDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2.C2H6/c1-6-8-4-3-7(10)5-9(8)12(2)11-6;1-2/h3-5H,1-2H3;1-2H3.
What are the key properties of 6-bromo-1,3-dimethylindazole;ethane?
6-bromo-1,3-dimethylindazole;ethane has a molecular weight of 255.16 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-dimethylindazole;ethane is sourced from PubChem (CID 145062136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).