C14H10Br2P2 — CID 89338350
(3,6-dibromo-10-phosphanylphenanthren-9-yl)phosphane (PubChem CID 89338350) has the molecular formula C14H10Br2P2 and a molecular weight of 399.99 g/mol. Its IUPAC name is (3,6-dibromo-10-phosphanylphenanthren-9-yl)phosphane.
| Compound Name | (3,6-dibromo-10-phosphanylphenanthren-9-yl)phosphane |
|---|---|
| PubChem CID | 89338350 |
| Molecular Formula | C14H10Br2P2 |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 397.86 |
| IUPAC Name | (3,6-dibromo-10-phosphanylphenanthren-9-yl)phosphane |
| SMILES | Pc1c(P)c2ccc(Br)cc2c2cc(Br)ccc12 |
| InChI | InChI=1S/C14H10Br2P2/c15-7-1-3-9-11(5-7)12-6-8(16)2-4-10(12)14(18)13(9)17/h1-6H,17-18H2 |
| InChIKey | PRHJGXZSJZRQOO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|