C23H20Br2N+ — CID 146013141
2,7-dibromo-10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium (PubChem CID 146013141) has the molecular formula C23H20Br2N+ and a molecular weight of 470.23 g/mol. Its IUPAC name is 2,7-dibromo-10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium.
| Compound Name | 2,7-dibromo-10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium |
|---|---|
| PubChem CID | 146013141 |
| Molecular Formula | C23H20Br2N+ |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 2,7-dibromo-10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium |
| SMILES | Cc1cc(C)c(-c2c3cc(Br)ccc3[n+](C)c3ccc(Br)cc23)c(C)c1 |
| InChI | InChI=1S/C23H20Br2N/c1-13-9-14(2)22(15(3)10-13)23-18-11-16(24)5-7-20(18)26(4)21-8-6-17(25)12-19(21)23/h5-12H,1-4H3/q+1 |
| InChIKey | PSPLREGIBHRKRV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|