C22H20NO+ — CID 154709083
3,5-dimethyl-2-(10-methylacridin-10-ium-9-yl)phenol (PubChem CID 154709083) has the molecular formula C22H20NO+ and a molecular weight of 314.41 g/mol. Its IUPAC name is 3,5-dimethyl-2-(10-methylacridin-10-ium-9-yl)phenol.
| Compound Name | 3,5-dimethyl-2-(10-methylacridin-10-ium-9-yl)phenol |
|---|---|
| PubChem CID | 154709083 |
| Molecular Formula | C22H20NO+ |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3,5-dimethyl-2-(10-methylacridin-10-ium-9-yl)phenol |
| SMILES | Cc1cc(C)c(-c2c3ccccc3[n+](C)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C22H19NO/c1-14-12-15(2)21(20(24)13-14)22-16-8-4-6-10-18(16)23(3)19-11-7-5-9-17(19)22/h4-13H,1-3H3/p+1 |
| InChIKey | YFHQEALIJKWJDG-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|