C28H24BF4N — CID 74766000
10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate (PubChem CID 74766000) has the molecular formula C28H24BF4N and a molecular weight of 461.31 g/mol. Its IUPAC name is 10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate.
| Compound Name | 10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
|---|---|
| PubChem CID | 74766000 |
| Molecular Formula | C28H24BF4N |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
| SMILES | Cc1cc(C)c(-c2c3ccccc3[n+](-c3ccccc3)c3ccccc23)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C28H24N.BF4/c1-19-17-20(2)27(21(3)18-19)28-23-13-7-9-15-25(23)29(22-11-5-4-6-12-22)26-16-10-8-14-24(26)28;2-1(3,4)5/h4-18H,1-3H3;/q+1;-1 |
| InChIKey | LGNMSOXRNBFBGX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|