C33H34N+ — CID 134553232
3-tert-butyl-6-methyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium (PubChem CID 134553232) has the molecular formula C33H34N+ and a molecular weight of 444.64 g/mol. Its IUPAC name is 3-tert-butyl-6-methyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium.
| Compound Name | 3-tert-butyl-6-methyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium |
|---|---|
| PubChem CID | 134553232 |
| Molecular Formula | C33H34N+ |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 3-tert-butyl-6-methyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium |
| SMILES | Cc1cc(C)c(-c2c3ccc(C)cc3[n+](-c3ccccc3)c3cc(C(C)(C)C)ccc23)c(C)c1 |
| InChI | InChI=1S/C33H34N/c1-21-13-15-27-29(19-21)34(26-11-9-8-10-12-26)30-20-25(33(5,6)7)14-16-28(30)32(27)31-23(3)17-22(2)18-24(31)4/h8-20H,1-7H3/q+1 |
| InChIKey | BBNRILJRTRZZOG-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|