C60H64 — CID 162426473
2,3,8-tritert-butyl-5,11-diphenyl-6,12-bis(2,4,6-trimethylphenyl)tetracene (PubChem CID 162426473) has the molecular formula C60H64 and a molecular weight of 785.17 g/mol. Its IUPAC name is 2,3,8-tritert-butyl-5,11-diphenyl-6,12-bis(2,4,6-trimethylphenyl)tetracene.
| Compound Name | 2,3,8-tritert-butyl-5,11-diphenyl-6,12-bis(2,4,6-trimethylphenyl)tetracene |
|---|---|
| PubChem CID | 162426473 |
| Molecular Formula | C60H64 |
| Molecular Weight | 785.17 g/mol |
| Exact Mass | 784.50 |
| IUPAC Name | 2,3,8-tritert-butyl-5,11-diphenyl-6,12-bis(2,4,6-trimethylphenyl)tetracene |
| SMILES | Cc1cc(C)c(-c2c3cc(C(C)(C)C)ccc3c(-c3ccccc3)c3c(-c4c(C)cc(C)cc4C)c4cc(C(C)(C)C)c(C(C)(C)C)cc4c(-c4ccccc4)c23)c(C)c1 |
| InChI | InChI=1S/C60H64/c1-35-28-37(3)50(38(4)29-35)54-45-32-43(58(7,8)9)26-27-44(45)52(41-22-18-16-19-23-41)56-55(51-39(5)30-36(2)31-40(51)6)47-34-49(60(13,14)15)48(59(10,11)12)33-46(47)53(57(54)56)42-24-20-17-21-25-42/h16-34H,1-15H3 |
| InChIKey | ZDGMDCCZDXLEIX-UHFFFAOYSA-N |
| XLogP | 17.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.17 |
| LogP ≤ 5 | 17.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|