C60H64 — CID 162426478
2,3,8,9-tetratert-butyl-5,11-bis(4-methylphenyl)-6,12-diphenyltetracene (PubChem CID 162426478) has the molecular formula C60H64 and a molecular weight of 785.17 g/mol. Its IUPAC name is 2,3,8,9-tetratert-butyl-5,11-bis(4-methylphenyl)-6,12-diphenyltetracene.
| Compound Name | 2,3,8,9-tetratert-butyl-5,11-bis(4-methylphenyl)-6,12-diphenyltetracene |
|---|---|
| PubChem CID | 162426478 |
| Molecular Formula | C60H64 |
| Molecular Weight | 785.17 g/mol |
| Exact Mass | 784.50 |
| IUPAC Name | 2,3,8,9-tetratert-butyl-5,11-bis(4-methylphenyl)-6,12-diphenyltetracene |
| SMILES | Cc1ccc(-c2c3cc(C(C)(C)C)c(C(C)(C)C)cc3c(-c3ccccc3)c3c(-c4ccc(C)cc4)c4cc(C(C)(C)C)c(C(C)(C)C)cc4c(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C60H64/c1-37-25-29-41(30-26-37)53-45-35-49(59(9,10)11)47(57(3,4)5)33-43(45)52(40-23-19-16-20-24-40)56-54(42-31-27-38(2)28-32-42)46-36-50(60(12,13)14)48(58(6,7)8)34-44(46)51(55(53)56)39-21-17-15-18-22-39/h15-36H,1-14H3 |
| InChIKey | KBNMFLQNAXGOOS-UHFFFAOYSA-N |
| XLogP | 17.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.17 |
| LogP ≤ 5 | 17.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|