C51H46 — CID 162426485
5-(4-tert-butylphenyl)-2,8-dimethyl-6,12-diphenyl-11-(4-propan-2-ylphenyl)tetracene (PubChem CID 162426485) has the molecular formula C51H46 and a molecular weight of 658.93 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2,8-dimethyl-6,12-diphenyl-11-(4-propan-2-ylphenyl)tetracene.
| Compound Name | 5-(4-tert-butylphenyl)-2,8-dimethyl-6,12-diphenyl-11-(4-propan-2-ylphenyl)tetracene |
|---|---|
| PubChem CID | 162426485 |
| Molecular Formula | C51H46 |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2,8-dimethyl-6,12-diphenyl-11-(4-propan-2-ylphenyl)tetracene |
| SMILES | Cc1ccc2c(-c3ccc(C(C)(C)C)cc3)c3c(-c4ccccc4)c4cc(C)ccc4c(-c4ccc(C(C)C)cc4)c3c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C51H46/c1-32(2)35-20-22-38(23-21-35)45-41-28-18-33(3)30-43(41)48(37-16-12-9-13-17-37)50-46(39-24-26-40(27-25-39)51(5,6)7)42-29-19-34(4)31-44(42)47(49(45)50)36-14-10-8-11-15-36/h8-32H,1-7H3 |
| InChIKey | YEOQYXNFNBYUKU-UHFFFAOYSA-N |
| XLogP | 14.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|