C53H50 — CID 162426516
2-tert-butyl-5,6,11,12-tetrakis(4-methylphenyl)-8-propan-2-yltetracene (PubChem CID 162426516) has the molecular formula C53H50 and a molecular weight of 686.98 g/mol. Its IUPAC name is 2-tert-butyl-5,6,11,12-tetrakis(4-methylphenyl)-8-propan-2-yltetracene.
| Compound Name | 2-tert-butyl-5,6,11,12-tetrakis(4-methylphenyl)-8-propan-2-yltetracene |
|---|---|
| PubChem CID | 162426516 |
| Molecular Formula | C53H50 |
| Molecular Weight | 686.98 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | 2-tert-butyl-5,6,11,12-tetrakis(4-methylphenyl)-8-propan-2-yltetracene |
| SMILES | Cc1ccc(-c2c3ccc(C(C)C)cc3c(-c3ccc(C)cc3)c3c(-c4ccc(C)cc4)c4ccc(C(C)(C)C)cc4c(-c4ccc(C)cc4)c23)cc1 |
| InChI | InChI=1S/C53H50/c1-32(2)41-26-28-43-45(30-41)49(39-22-14-35(5)15-23-39)51-48(38-20-12-34(4)13-21-38)44-29-27-42(53(7,8)9)31-46(44)50(40-24-16-36(6)17-25-40)52(51)47(43)37-18-10-33(3)11-19-37/h10-32H,1-9H3 |
| InChIKey | UZSNTZQUOYEUAL-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.98 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|